C16H13N5O3 — CID 108851529
methyl 2-[[(Z)-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enoyl]amino]benzoate (PubChem CID 108851529) has the molecular formula C16H13N5O3 and a molecular weight of 323.31 g/mol. Its IUPAC name is methyl 2-[[(Z)-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 2-[[(Z)-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108851529 |
| Molecular Formula | C16H13N5O3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | methyl 2-[[(Z)-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)/C(C#N)=C\Nc1ncccn1 |
| InChI | InChI=1S/C16H13N5O3/c1-24-15(23)12-5-2-3-6-13(12)21-14(22)11(9-17)10-20-16-18-7-4-8-19-16/h2-8,10H,1H3,(H,21,22)(H,18,19,20)/b11-10- |
| InChIKey | XASSLSAIFMRNDK-KHPPLWFESA-N |
| XLogP | 1.72 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|