C19H14N4OS2 — CID 108857108
(Z)-2-cyano-N-(2-phenylsulfanylphenyl)-3-(1,3-thiazol-2-ylamino)prop-2-enamide (PubChem CID 108857108) has the molecular formula C19H14N4OS2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-phenylsulfanylphenyl)-3-(1,3-thiazol-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-phenylsulfanylphenyl)-3-(1,3-thiazol-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108857108 |
| Molecular Formula | C19H14N4OS2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | (Z)-2-cyano-N-(2-phenylsulfanylphenyl)-3-(1,3-thiazol-2-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1nccs1)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C19H14N4OS2/c20-12-14(13-22-19-21-10-11-25-19)18(24)23-16-8-4-5-9-17(16)26-15-6-2-1-3-7-15/h1-11,13H,(H,21,22)(H,23,24)/b14-13- |
| InChIKey | NOXOUGHPXBJCFM-YPKPFQOOSA-N |
| XLogP | 4.75 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|