C17H13N3O2S2 — CID 108515122
N-(2-phenylsulfanylphenyl)-N'-(1,3-thiazol-2-yl)oxamide (PubChem CID 108515122) has the molecular formula C17H13N3O2S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(2-phenylsulfanylphenyl)-N'-(1,3-thiazol-2-yl)oxamide.
| Compound Name | N-(2-phenylsulfanylphenyl)-N'-(1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 108515122 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-(2-phenylsulfanylphenyl)-N'-(1,3-thiazol-2-yl)oxamide |
| SMILES | O=C(Nc1nccs1)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C17H13N3O2S2/c21-15(16(22)20-17-18-10-11-23-17)19-13-8-4-5-9-14(13)24-12-6-2-1-3-7-12/h1-11H,(H,19,21)(H,18,20,22) |
| InChIKey | OUYOMJANFFPCCO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|