C18H14N2OS — CID 154975421
3,3-diphenyl-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 154975421) has the molecular formula C18H14N2OS and a molecular weight of 306.39 g/mol. Its IUPAC name is 3,3-diphenyl-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 3,3-diphenyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 154975421 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3,3-diphenyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(C=C(c1ccccc1)c1ccccc1)Nc1nccs1 |
| InChI | InChI=1S/C18H14N2OS/c21-17(20-18-19-11-12-22-18)13-16(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H,(H,19,20,21) |
| InChIKey | VFWZKLCTWXTYFU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|