C10H8N2O2S — CID 174937063
(1,3-thiazol-2-ylamino) benzoate (PubChem CID 174937063) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is (1,3-thiazol-2-ylamino) benzoate.
| Compound Name | (1,3-thiazol-2-ylamino) benzoate |
|---|---|
| PubChem CID | 174937063 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | (1,3-thiazol-2-ylamino) benzoate |
| SMILES | O=C(ONc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C10H8N2O2S/c13-9(8-4-2-1-3-5-8)14-12-10-11-6-7-15-10/h1-7H,(H,11,12) |
| InChIKey | CONRWUNUYUHLEM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|