About (quinolin-4-ylamino) benzoate
(quinolin-4-ylamino) benzoate (PubChem CID 23468711) has the molecular formula C16H12N2O2
and a molecular weight of 264.28 g/mol. Its IUPAC name is (quinolin-4-ylamino) benzoate.
Molecular Properties
| Compound Name | (quinolin-4-ylamino) benzoate |
| PubChem CID | 23468711 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (quinolin-4-ylamino) benzoate |
| SMILES | O=C(ONc1ccnc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C16H12N2O2/c19-16(12-6-2-1-3-7-12)20-18-15-10-11-17-14-9-5-4-8-13(14)15/h1-11H,(H,17,18) |
| InChIKey | OUWQRWTYMHTEAX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (quinolin-4-ylamino) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (quinolin-4-ylamino) benzoate?
The IUPAC name of (quinolin-4-ylamino) benzoate (CID 23468711) is (quinolin-4-ylamino) benzoate.
What is the SMILES notation for (quinolin-4-ylamino) benzoate?
The canonical SMILES for (quinolin-4-ylamino) benzoate is O=C(ONc1ccnc2ccccc12)c1ccccc1.
What is the InChIKey of (quinolin-4-ylamino) benzoate?
The InChIKey is OUWQRWTYMHTEAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2/c19-16(12-6-2-1-3-7-12)20-18-15-10-11-17-14-9-5-4-8-13(14)15/h1-11H,(H,17,18).
What are the key properties of (quinolin-4-ylamino) benzoate?
(quinolin-4-ylamino) benzoate has a molecular weight of 264.28 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (quinolin-4-ylamino) benzoate is sourced from PubChem (CID 23468711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).