C24H18N6O6 — CID 90935192
[[4,6-bis(benzoyloxyamino)-1,3,5-triazin-2-yl]amino] benzoate (PubChem CID 90935192) has the molecular formula C24H18N6O6 and a molecular weight of 486.44 g/mol. Its IUPAC name is [[4,6-bis(benzoyloxyamino)-1,3,5-triazin-2-yl]amino] benzoate.
| Compound Name | [[4,6-bis(benzoyloxyamino)-1,3,5-triazin-2-yl]amino] benzoate |
|---|---|
| PubChem CID | 90935192 |
| Molecular Formula | C24H18N6O6 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [[4,6-bis(benzoyloxyamino)-1,3,5-triazin-2-yl]amino] benzoate |
| SMILES | O=C(ONc1nc(NOC(=O)c2ccccc2)nc(NOC(=O)c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C24H18N6O6/c31-19(16-10-4-1-5-11-16)34-28-22-25-23(29-35-20(32)17-12-6-2-7-13-17)27-24(26-22)30-36-21(33)18-14-8-3-9-15-18/h1-15H,(H3,25,26,27,28,29,30) |
| InChIKey | SUTFYXSLMHWOPX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|