C15H14ClN3O3S — CID 88648161
2-(2-chloropropanoylamino)-3-oxo-3-phenyl-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 88648161) has the molecular formula C15H14ClN3O3S and a molecular weight of 351.82 g/mol. Its IUPAC name is 2-(2-chloropropanoylamino)-3-oxo-3-phenyl-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-(2-chloropropanoylamino)-3-oxo-3-phenyl-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 88648161 |
| Molecular Formula | C15H14ClN3O3S |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-(2-chloropropanoylamino)-3-oxo-3-phenyl-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CC(Cl)C(=O)NC(C(=O)Nc1nccs1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14ClN3O3S/c1-9(16)13(21)18-11(12(20)10-5-3-2-4-6-10)14(22)19-15-17-7-8-23-15/h2-9,11H,1H3,(H,18,21)(H,17,19,22) |
| InChIKey | QYRWOLLICOIHFJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|