C16H15Cl2N3O4S — CID 88631399
2-[(2-chloro-3-methoxypropanoyl)amino]-3-(4-chlorophenyl)-3-oxo-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 88631399) has the molecular formula C16H15Cl2N3O4S and a molecular weight of 416.29 g/mol. Its IUPAC name is 2-[(2-chloro-3-methoxypropanoyl)amino]-3-(4-chlorophenyl)-3-oxo-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-[(2-chloro-3-methoxypropanoyl)amino]-3-(4-chlorophenyl)-3-oxo-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 88631399 |
| Molecular Formula | C16H15Cl2N3O4S |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 2-[(2-chloro-3-methoxypropanoyl)amino]-3-(4-chlorophenyl)-3-oxo-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | COCC(Cl)C(=O)NC(C(=O)Nc1nccs1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O4S/c1-25-8-11(18)14(23)20-12(15(24)21-16-19-6-7-26-16)13(22)9-2-4-10(17)5-3-9/h2-7,11-12H,8H2,1H3,(H,20,23)(H,19,21,24) |
| InChIKey | RQHTYUBIHYEVPB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|