C15H10Cl2F3N3O3S — CID 88696270
2-[(2,2-dichloroacetyl)amino]-3-oxo-N-(1,3-thiazol-2-yl)-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 88696270) has the molecular formula C15H10Cl2F3N3O3S and a molecular weight of 440.23 g/mol. Its IUPAC name is 2-[(2,2-dichloroacetyl)amino]-3-oxo-N-(1,3-thiazol-2-yl)-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[(2,2-dichloroacetyl)amino]-3-oxo-N-(1,3-thiazol-2-yl)-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 88696270 |
| Molecular Formula | C15H10Cl2F3N3O3S |
| Molecular Weight | 440.23 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 2-[(2,2-dichloroacetyl)amino]-3-oxo-N-(1,3-thiazol-2-yl)-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(NC(C(=O)Nc1nccs1)C(=O)c1cccc(C(F)(F)F)c1)C(Cl)Cl |
| InChI | InChI=1S/C15H10Cl2F3N3O3S/c16-11(17)13(26)22-9(12(25)23-14-21-4-5-27-14)10(24)7-2-1-3-8(6-7)15(18,19)20/h1-6,9,11H,(H,22,26)(H,21,23,25) |
| InChIKey | OJOYVXGLDZGNFC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|