C14H10Cl2FN3O3S — CID 13381341
3-[2-[(2,2-dichloroacetyl)amino]-3-fluorophenyl]-3-oxo-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 13381341) has the molecular formula C14H10Cl2FN3O3S and a molecular weight of 390.22 g/mol. Its IUPAC name is 3-[2-[(2,2-dichloroacetyl)amino]-3-fluorophenyl]-3-oxo-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[2-[(2,2-dichloroacetyl)amino]-3-fluorophenyl]-3-oxo-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 13381341 |
| Molecular Formula | C14H10Cl2FN3O3S |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 3-[2-[(2,2-dichloroacetyl)amino]-3-fluorophenyl]-3-oxo-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CC(=O)c1cccc(F)c1NC(=O)C(Cl)Cl)Nc1nccs1 |
| InChI | InChI=1S/C14H10Cl2FN3O3S/c15-12(16)13(23)20-11-7(2-1-3-8(11)17)9(21)6-10(22)19-14-18-4-5-24-14/h1-5,12H,6H2,(H,20,23)(H,18,19,22) |
| InChIKey | RKEOCBIBRGXJFO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|