C11H8F2N2OS — CID 110488848
2-(2,4-difluorophenyl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 110488848) has the molecular formula C11H8F2N2OS and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2,4-difluorophenyl)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 110488848 |
| Molecular Formula | C11H8F2N2OS |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1F)Nc1nccs1 |
| InChI | InChI=1S/C11H8F2N2OS/c12-8-2-1-7(9(13)6-8)5-10(16)15-11-14-3-4-17-11/h1-4,6H,5H2,(H,14,15,16) |
| InChIKey | NGHFMKDADIVOTI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |