C11H9F2N3OS — CID 175993315
(2R)-2-amino-2-(2,5-difluorophenyl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 175993315) has the molecular formula C11H9F2N3OS and a molecular weight of 269.28 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,5-difluorophenyl)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | (2R)-2-amino-2-(2,5-difluorophenyl)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 175993315 |
| Molecular Formula | C11H9F2N3OS |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (2R)-2-amino-2-(2,5-difluorophenyl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | N[C@@H](C(=O)Nc1nccs1)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H9F2N3OS/c12-6-1-2-8(13)7(5-6)9(14)10(17)16-11-15-3-4-18-11/h1-5,9H,14H2,(H,15,16,17)/t9-/m1/s1 |
| InChIKey | MFLODHQOEWPMAQ-SECBINFHSA-N |
| XLogP | 2.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |