C10H13F2N3O — CID 116849798
2-amino-2-(2,5-difluorophenyl)-N',N'-dimethylacetohydrazide (PubChem CID 116849798) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-amino-2-(2,5-difluorophenyl)-N',N'-dimethylacetohydrazide.
| Compound Name | 2-amino-2-(2,5-difluorophenyl)-N',N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 116849798 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-amino-2-(2,5-difluorophenyl)-N',N'-dimethylacetohydrazide |
| SMILES | CN(C)NC(=O)C(N)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H13F2N3O/c1-15(2)14-10(16)9(13)7-5-6(11)3-4-8(7)12/h3-5,9H,13H2,1-2H3,(H,14,16) |
| InChIKey | MHEWJZSGKPZIFG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|