C11H16FN3O — CID 116849968
2-amino-3-(3-fluorophenyl)-N',N'-dimethylpropanehydrazide (PubChem CID 116849968) has the molecular formula C11H16FN3O and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-amino-3-(3-fluorophenyl)-N',N'-dimethylpropanehydrazide.
| Compound Name | 2-amino-3-(3-fluorophenyl)-N',N'-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 116849968 |
| Molecular Formula | C11H16FN3O |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-amino-3-(3-fluorophenyl)-N',N'-dimethylpropanehydrazide |
| SMILES | CN(C)NC(=O)C(N)Cc1cccc(F)c1 |
| InChI | InChI=1S/C11H16FN3O/c1-15(2)14-11(16)10(13)7-8-4-3-5-9(12)6-8/h3-6,10H,7,13H2,1-2H3,(H,14,16) |
| InChIKey | UZVPUNPGHIUUNC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|