C15H24FNO — CID 177211939
(Z,2S)-2-amino-1-(3-fluorophenyl)-4-methylhex-4-en-3-one;ethane;molecular hydrogen (PubChem CID 177211939) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is (Z,2S)-2-amino-1-(3-fluorophenyl)-4-methylhex-4-en-3-one;ethane;molecular hydrogen.
| Compound Name | (Z,2S)-2-amino-1-(3-fluorophenyl)-4-methylhex-4-en-3-one;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 177211939 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (Z,2S)-2-amino-1-(3-fluorophenyl)-4-methylhex-4-en-3-one;ethane;molecular hydrogen |
| SMILES | C/C=C(/C)C(=O)[C@@H](N)Cc1cccc(F)c1.CC.[H][H] |
| InChI | InChI=1S/C13H16FNO.C2H6.H2/c1-3-9(2)13(16)12(15)8-10-5-4-6-11(14)7-10;1-2;/h3-7,12H,8,15H2,1-2H3;1-2H3;1H/b9-3-;;/t12-;;/m0../s1 |
| InChIKey | BQLSAUFKNLCTQV-QMZMPOHLSA-N |
| XLogP | 3.50 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|