C15H19N3O — CID 116849985
2-amino-N',N'-dimethyl-3-naphthalen-2-ylpropanehydrazide (PubChem CID 116849985) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-amino-N',N'-dimethyl-3-naphthalen-2-ylpropanehydrazide.
| Compound Name | 2-amino-N',N'-dimethyl-3-naphthalen-2-ylpropanehydrazide |
|---|---|
| PubChem CID | 116849985 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-amino-N',N'-dimethyl-3-naphthalen-2-ylpropanehydrazide |
| SMILES | CN(C)NC(=O)C(N)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H19N3O/c1-18(2)17-15(19)14(16)10-11-7-8-12-5-3-4-6-13(12)9-11/h3-9,14H,10,16H2,1-2H3,(H,17,19) |
| InChIKey | DCJSJYUSOLSHLF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|