C9H9F2NO2 — CID 51888842
methyl (2S)-2-amino-2-(2,5-difluorophenyl)acetate (PubChem CID 51888842) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-(2,5-difluorophenyl)acetate.
| Compound Name | methyl (2S)-2-amino-2-(2,5-difluorophenyl)acetate |
|---|---|
| PubChem CID | 51888842 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | methyl (2S)-2-amino-2-(2,5-difluorophenyl)acetate |
| SMILES | COC(=O)[C@@H](N)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H9F2NO2/c1-14-9(13)8(12)6-4-5(10)2-3-7(6)11/h2-4,8H,12H2,1H3/t8-/m0/s1 |
| InChIKey | BHZBIYYWIUHYAX-QMMMGPOBSA-N |
| XLogP | 1.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |