C9H9ClF3NO2 — CID 171224868
methyl (2R)-2-amino-2-(2,3,5-trifluorophenyl)acetate;hydrochloride (PubChem CID 171224868) has the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-(2,3,5-trifluorophenyl)acetate;hydrochloride.
| Compound Name | methyl (2R)-2-amino-2-(2,3,5-trifluorophenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 171224868 |
| Molecular Formula | C9H9ClF3NO2 |
| Molecular Weight | 255.62 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | methyl (2R)-2-amino-2-(2,3,5-trifluorophenyl)acetate;hydrochloride |
| SMILES | COC(=O)[C@H](N)c1cc(F)cc(F)c1F.Cl |
| InChI | InChI=1S/C9H8F3NO2.ClH/c1-15-9(14)8(13)5-2-4(10)3-6(11)7(5)12;/h2-3,8H,13H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | HZWSSFMORHUUQN-DDWIOCJRSA-N |
| XLogP | 1.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.62 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|