C9H9ClFNO3 — CID 131512220
methyl (2S)-2-amino-2-(3-chloro-5-fluoro-2-hydroxyphenyl)acetate (PubChem CID 131512220) has the molecular formula C9H9ClFNO3 and a molecular weight of 233.63 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-(3-chloro-5-fluoro-2-hydroxyphenyl)acetate.
| Compound Name | methyl (2S)-2-amino-2-(3-chloro-5-fluoro-2-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 131512220 |
| Molecular Formula | C9H9ClFNO3 |
| Molecular Weight | 233.63 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | methyl (2S)-2-amino-2-(3-chloro-5-fluoro-2-hydroxyphenyl)acetate |
| SMILES | COC(=O)[C@@H](N)c1cc(F)cc(Cl)c1O |
| InChI | InChI=1S/C9H9ClFNO3/c1-15-9(14)7(12)5-2-4(11)3-6(10)8(5)13/h2-3,7,13H,12H2,1H3/t7-/m0/s1 |
| InChIKey | GGUXAFVMLQFOLS-ZETCQYMHSA-N |
| XLogP | 1.36 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.63 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|