C8H6ClFO4 — CID 117314960
2-(3-chloro-5-fluoro-2-hydroxyphenyl)-2-hydroxyacetic acid (PubChem CID 117314960) has the molecular formula C8H6ClFO4 and a molecular weight of 220.58 g/mol. Its IUPAC name is 2-(3-chloro-5-fluoro-2-hydroxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(3-chloro-5-fluoro-2-hydroxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117314960 |
| Molecular Formula | C8H6ClFO4 |
| Molecular Weight | 220.58 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 2-(3-chloro-5-fluoro-2-hydroxyphenyl)-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cc(F)cc(Cl)c1O |
| InChI | InChI=1S/C8H6ClFO4/c9-5-2-3(10)1-4(6(5)11)7(12)8(13)14/h1-2,7,11-12H,(H,13,14) |
| InChIKey | DDCHGLOSODNKPP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.58 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |