C9H10ClFO4 — CID 170817813
1-(3-chloro-5-fluoro-2-hydroxyphenyl)propane-1,2,3-triol (PubChem CID 170817813) has the molecular formula C9H10ClFO4 and a molecular weight of 236.63 g/mol. Its IUPAC name is 1-(3-chloro-5-fluoro-2-hydroxyphenyl)propane-1,2,3-triol.
| Compound Name | 1-(3-chloro-5-fluoro-2-hydroxyphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817813 |
| Molecular Formula | C9H10ClFO4 |
| Molecular Weight | 236.63 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 1-(3-chloro-5-fluoro-2-hydroxyphenyl)propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1cc(F)cc(Cl)c1O |
| InChI | InChI=1S/C9H10ClFO4/c10-6-2-4(11)1-5(8(6)14)9(15)7(13)3-12/h1-2,7,9,12-15H,3H2 |
| InChIKey | YWDBBBNTRJGXJU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.63 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |