C9H9F2NO5 — CID 170818529
1-(3,5-difluoro-2-nitrophenyl)propane-1,2,3-triol (PubChem CID 170818529) has the molecular formula C9H9F2NO5 and a molecular weight of 249.17 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-nitrophenyl)propane-1,2,3-triol.
| Compound Name | 1-(3,5-difluoro-2-nitrophenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818529 |
| Molecular Formula | C9H9F2NO5 |
| Molecular Weight | 249.17 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1-(3,5-difluoro-2-nitrophenyl)propane-1,2,3-triol |
| SMILES | O=[N+]([O-])c1c(F)cc(F)cc1C(O)C(O)CO |
| InChI | InChI=1S/C9H9F2NO5/c10-4-1-5(9(15)7(14)3-13)8(12(16)17)6(11)2-4/h1-2,7,9,13-15H,3H2 |
| InChIKey | TYJWTXFPJRWVFK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|