C17H21F2NO6 — CID 23541886
ditert-butyl 2-(3,5-difluoro-2-nitrophenyl)propanedioate (PubChem CID 23541886) has the molecular formula C17H21F2NO6 and a molecular weight of 373.35 g/mol. Its IUPAC name is ditert-butyl 2-(3,5-difluoro-2-nitrophenyl)propanedioate.
| Compound Name | ditert-butyl 2-(3,5-difluoro-2-nitrophenyl)propanedioate |
|---|---|
| PubChem CID | 23541886 |
| Molecular Formula | C17H21F2NO6 |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | ditert-butyl 2-(3,5-difluoro-2-nitrophenyl)propanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)c1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21F2NO6/c1-16(2,3)25-14(21)12(15(22)26-17(4,5)6)10-7-9(18)8-11(19)13(10)20(23)24/h7-8,12H,1-6H3 |
| InChIKey | PFOJBYJEHUXUMR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|