C16H21F2N3O4 — CID 71055097
tert-butyl 4-(3,5-difluoro-2-nitroanilino)piperidine-1-carboxylate (PubChem CID 71055097) has the molecular formula C16H21F2N3O4 and a molecular weight of 357.36 g/mol. Its IUPAC name is tert-butyl 4-(3,5-difluoro-2-nitroanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3,5-difluoro-2-nitroanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71055097 |
| Molecular Formula | C16H21F2N3O4 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | tert-butyl 4-(3,5-difluoro-2-nitroanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(F)cc(F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H21F2N3O4/c1-16(2,3)25-15(22)20-6-4-11(5-7-20)19-13-9-10(17)8-12(18)14(13)21(23)24/h8-9,11,19H,4-7H2,1-3H3 |
| InChIKey | ALRSOCMPCKNNBI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|