C16H23F2N3O2 — CID 89230805
tert-butyl 4-(2-amino-3,5-difluoroanilino)piperidine-1-carboxylate (PubChem CID 89230805) has the molecular formula C16H23F2N3O2 and a molecular weight of 327.38 g/mol. Its IUPAC name is tert-butyl 4-(2-amino-3,5-difluoroanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-amino-3,5-difluoroanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89230805 |
| Molecular Formula | C16H23F2N3O2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | tert-butyl 4-(2-amino-3,5-difluoroanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(F)cc(F)c2N)CC1 |
| InChI | InChI=1S/C16H23F2N3O2/c1-16(2,3)23-15(22)21-6-4-11(5-7-21)20-13-9-10(17)8-12(18)14(13)19/h8-9,11,20H,4-7,19H2,1-3H3 |
| InChIKey | GLVGXUQNYDPWJR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|