C18H27N3O4 — CID 71623656
tert-butyl 4-(2-amino-3-methoxycarbonylanilino)piperidine-1-carboxylate (PubChem CID 71623656) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is tert-butyl 4-(2-amino-3-methoxycarbonylanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-amino-3-methoxycarbonylanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71623656 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | tert-butyl 4-(2-amino-3-methoxycarbonylanilino)piperidine-1-carboxylate |
| SMILES | COC(=O)c1cccc(NC2CCN(C(=O)OC(C)(C)C)CC2)c1N |
| InChI | InChI=1S/C18H27N3O4/c1-18(2,3)25-17(23)21-10-8-12(9-11-21)20-14-7-5-6-13(15(14)19)16(22)24-4/h5-7,12,20H,8-11,19H2,1-4H3 |
| InChIKey | BJGOBVBHPZUFSA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|