C20H30FN3O2 — CID 168514201
tert-butyl 4-(3-fluoro-2-pyrrolidin-1-ylanilino)piperidine-1-carboxylate (PubChem CID 168514201) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is tert-butyl 4-(3-fluoro-2-pyrrolidin-1-ylanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-fluoro-2-pyrrolidin-1-ylanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168514201 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | tert-butyl 4-(3-fluoro-2-pyrrolidin-1-ylanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cccc(F)c2N2CCCC2)CC1 |
| InChI | InChI=1S/C20H30FN3O2/c1-20(2,3)26-19(25)24-13-9-15(10-14-24)22-17-8-6-7-16(21)18(17)23-11-4-5-12-23/h6-8,15,22H,4-5,9-14H2,1-3H3 |
| InChIKey | NEIWIDQWSSPFPJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |