C20H28FN3O4 — CID 143429988
tert-butyl 4-(5-cyclobutyl-3-fluoro-2-nitroanilino)piperidine-1-carboxylate (PubChem CID 143429988) has the molecular formula C20H28FN3O4 and a molecular weight of 393.46 g/mol. Its IUPAC name is tert-butyl 4-(5-cyclobutyl-3-fluoro-2-nitroanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-cyclobutyl-3-fluoro-2-nitroanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143429988 |
| Molecular Formula | C20H28FN3O4 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | tert-butyl 4-(5-cyclobutyl-3-fluoro-2-nitroanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(C3CCC3)cc(F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H28FN3O4/c1-20(2,3)28-19(25)23-9-7-15(8-10-23)22-17-12-14(13-5-4-6-13)11-16(21)18(17)24(26)27/h11-13,15,22H,4-10H2,1-3H3 |
| InChIKey | YDHHZOIRMDYHQU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|