C11H14F2N2O4 — CID 171890907
1-(3,5-difluoro-2-nitrophenyl)-4-(methylamino)butane-1,2-diol (PubChem CID 171890907) has the molecular formula C11H14F2N2O4 and a molecular weight of 276.24 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-nitrophenyl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(3,5-difluoro-2-nitrophenyl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171890907 |
| Molecular Formula | C11H14F2N2O4 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1-(3,5-difluoro-2-nitrophenyl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14F2N2O4/c1-14-3-2-9(16)11(17)7-4-6(12)5-8(13)10(7)15(18)19/h4-5,9,11,14,16-17H,2-3H2,1H3 |
| InChIKey | UTGDJLVIWMIECJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|