C13H18N2O5 — CID 171891152
1-[4-[1,2-dihydroxy-4-(methylamino)butyl]-3-nitrophenyl]ethanone (PubChem CID 171891152) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-[4-[1,2-dihydroxy-4-(methylamino)butyl]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[1,2-dihydroxy-4-(methylamino)butyl]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 171891152 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-[4-[1,2-dihydroxy-4-(methylamino)butyl]-3-nitrophenyl]ethanone |
| SMILES | CNCCC(O)C(O)c1ccc(C(C)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N2O5/c1-8(16)9-3-4-10(11(7-9)15(19)20)13(18)12(17)5-6-14-2/h3-4,7,12-14,17-18H,5-6H2,1-2H3 |
| InChIKey | JYNKBZDNVBDRDQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|