C11H12N2O6 — CID 171869098
3-(4-acetyl-2-nitrophenyl)-2,3-dihydroxypropanamide (PubChem CID 171869098) has the molecular formula C11H12N2O6 and a molecular weight of 268.23 g/mol. Its IUPAC name is 3-(4-acetyl-2-nitrophenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(4-acetyl-2-nitrophenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869098 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-(4-acetyl-2-nitrophenyl)-2,3-dihydroxypropanamide |
| SMILES | CC(=O)c1ccc(C(O)C(O)C(N)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N2O6/c1-5(14)6-2-3-7(8(4-6)13(18)19)9(15)10(16)11(12)17/h2-4,9-10,15-16H,1H3,(H2,12,17) |
| InChIKey | FNRMMEZQDHJECZ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|