C12H13NO8 — CID 170824961
3-(4-ethoxycarbonyl-2-nitrophenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170824961) has the molecular formula C12H13NO8 and a molecular weight of 299.24 g/mol. Its IUPAC name is 3-(4-ethoxycarbonyl-2-nitrophenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(4-ethoxycarbonyl-2-nitrophenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170824961 |
| Molecular Formula | C12H13NO8 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-(4-ethoxycarbonyl-2-nitrophenyl)-2,3-dihydroxypropanoic acid |
| SMILES | CCOC(=O)c1ccc(C(O)C(O)C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13NO8/c1-2-21-12(18)6-3-4-7(8(5-6)13(19)20)9(14)10(15)11(16)17/h3-5,9-10,14-15H,2H2,1H3,(H,16,17) |
| InChIKey | BRSFEKQLOMZAAX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|