C13H18N2O6 — CID 171882262
ethyl 4-(4-amino-1,2-dihydroxybutyl)-3-nitrobenzoate (PubChem CID 171882262) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is ethyl 4-(4-amino-1,2-dihydroxybutyl)-3-nitrobenzoate.
| Compound Name | ethyl 4-(4-amino-1,2-dihydroxybutyl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 171882262 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | ethyl 4-(4-amino-1,2-dihydroxybutyl)-3-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc(C(O)C(O)CCN)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H18N2O6/c1-2-21-13(18)8-3-4-9(10(7-8)15(19)20)12(17)11(16)5-6-14/h3-4,7,11-12,16-17H,2,5-6,14H2,1H3 |
| InChIKey | ZOXLTLNGFSUOKI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|