C12H16FNO4 — CID 171881807
methyl 3-(4-amino-1,2-dihydroxybutyl)-4-fluorobenzoate (PubChem CID 171881807) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is methyl 3-(4-amino-1,2-dihydroxybutyl)-4-fluorobenzoate.
| Compound Name | methyl 3-(4-amino-1,2-dihydroxybutyl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 171881807 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | methyl 3-(4-amino-1,2-dihydroxybutyl)-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(C(O)C(O)CCN)c1 |
| InChI | InChI=1S/C12H16FNO4/c1-18-12(17)7-2-3-9(13)8(6-7)11(16)10(15)4-5-14/h2-3,6,10-11,15-16H,4-5,14H2,1H3 |
| InChIKey | WEQNENVJCQIGRB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |