C12H13FO6 — CID 171895857
3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid (PubChem CID 171895857) has the molecular formula C12H13FO6 and a molecular weight of 272.23 g/mol. Its IUPAC name is 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid.
| Compound Name | 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 171895857 |
| Molecular Formula | C12H13FO6 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid |
| SMILES | COC(=O)CC(O)C(O)c1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C12H13FO6/c1-19-10(15)5-9(14)11(16)7-4-6(12(17)18)2-3-8(7)13/h2-4,9,11,14,16H,5H2,1H3,(H,17,18) |
| InChIKey | SKOPKYBWLBGNOI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |