3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid

C12H13FO6 — CID 171895857

IUPAC3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid
SMILESCOC(=O)CC(O)C(O)c1cc(C(=O)O)ccc1F
InChIInChI=1S/C12H13FO6/c1-19-10(15)5-9(14)11(16)7-4-6(12(17)18)2-3-8(7)13/h2-4,9,11,14,16H,5H2,1H3,(H,17,18)
InChIKeySKOPKYBWLBGNOI-UHFFFAOYSA-N
MW272.23 g/mol
LogP0.48
Rot. Bonds5

About 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid

3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid (PubChem CID 171895857) has the molecular formula C12H13FO6 and a molecular weight of 272.23 g/mol. Its IUPAC name is 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid.

Molecular Properties

Compound Name3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid
PubChem CID171895857
Molecular FormulaC12H13FO6
Molecular Weight272.23 g/mol
Exact Mass272.07
IUPAC Name3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid
SMILESCOC(=O)CC(O)C(O)c1cc(C(=O)O)ccc1F
InChIInChI=1S/C12H13FO6/c1-19-10(15)5-9(14)11(16)7-4-6(12(17)18)2-3-8(7)13/h2-4,9,11,14,16H,5H2,1H3,(H,17,18)
InChIKeySKOPKYBWLBGNOI-UHFFFAOYSA-N
XLogP0.48
TPSA104.06 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.23
LogP ≤ 50.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid?
The IUPAC name of 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid (CID 171895857) is 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid.
What is the SMILES notation for 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid?
The canonical SMILES for 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid is COC(=O)CC(O)C(O)c1cc(C(=O)O)ccc1F.
What is the InChIKey of 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid?
The InChIKey is SKOPKYBWLBGNOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO6/c1-19-10(15)5-9(14)11(16)7-4-6(12(17)18)2-3-8(7)13/h2-4,9,11,14,16H,5H2,1H3,(H,17,18).
What are the key properties of 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid?
3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid has a molecular weight of 272.23 g/mol, XLogP of 0.48, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-fluorobenzoic acid is sourced from PubChem (CID 171895857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).