C11H10F4O4 — CID 171895845
methyl 3,4-dihydroxy-4-(2,3,5,6-tetrafluorophenyl)butanoate (PubChem CID 171895845) has the molecular formula C11H10F4O4 and a molecular weight of 282.19 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(2,3,5,6-tetrafluorophenyl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(2,3,5,6-tetrafluorophenyl)butanoate |
|---|---|
| PubChem CID | 171895845 |
| Molecular Formula | C11H10F4O4 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(2,3,5,6-tetrafluorophenyl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H10F4O4/c1-19-7(17)3-6(16)11(18)8-9(14)4(12)2-5(13)10(8)15/h2,6,11,16,18H,3H2,1H3 |
| InChIKey | OEXJSKFTUICSJW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|