C13H14F4O4 — CID 145399399
methyl 4-hydroxy-3-methyl-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 145399399) has the molecular formula C13H14F4O4 and a molecular weight of 310.24 g/mol. Its IUPAC name is methyl 4-hydroxy-3-methyl-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | methyl 4-hydroxy-3-methyl-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 145399399 |
| Molecular Formula | C13H14F4O4 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | methyl 4-hydroxy-3-methyl-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | COC(=O)CC(C)C(O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H14F4O4/c1-6(3-10(19)20-2)9(18)5-21-13-11(16)7(14)4-8(15)12(13)17/h4,6,9,18H,3,5H2,1-2H3 |
| InChIKey | GOCJUESIFAUBIK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|