C13H15F4NO3 — CID 103289999
methyl 2-(propylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanoate (PubChem CID 103289999) has the molecular formula C13H15F4NO3 and a molecular weight of 309.26 g/mol. Its IUPAC name is methyl 2-(propylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanoate.
| Compound Name | methyl 2-(propylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanoate |
|---|---|
| PubChem CID | 103289999 |
| Molecular Formula | C13H15F4NO3 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 2-(propylamino)-3-(2,3,5,6-tetrafluorophenoxy)propanoate |
| SMILES | CCCNC(COc1c(F)c(F)cc(F)c1F)C(=O)OC |
| InChI | InChI=1S/C13H15F4NO3/c1-3-4-18-9(13(19)20-2)6-21-12-10(16)7(14)5-8(15)11(12)17/h5,9,18H,3-4,6H2,1-2H3 |
| InChIKey | SVQFGODHTTWDPZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|