C12H11F4NO4 — CID 103288839
methyl 2-acetamido-3-(2,3,5,6-tetrafluorophenoxy)propanoate (PubChem CID 103288839) has the molecular formula C12H11F4NO4 and a molecular weight of 309.22 g/mol. Its IUPAC name is methyl 2-acetamido-3-(2,3,5,6-tetrafluorophenoxy)propanoate.
| Compound Name | methyl 2-acetamido-3-(2,3,5,6-tetrafluorophenoxy)propanoate |
|---|---|
| PubChem CID | 103288839 |
| Molecular Formula | C12H11F4NO4 |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | methyl 2-acetamido-3-(2,3,5,6-tetrafluorophenoxy)propanoate |
| SMILES | COC(=O)C(COc1c(F)c(F)cc(F)c1F)NC(C)=O |
| InChI | InChI=1S/C12H11F4NO4/c1-5(18)17-8(12(19)20-2)4-21-11-9(15)6(13)3-7(14)10(11)16/h3,8H,4H2,1-2H3,(H,17,18) |
| InChIKey | JJRSZWKIVQQFRP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|