C12H13F2NO3 — CID 54100440
methyl (2S)-2-acetamido-3-(2,4-difluorophenyl)propanoate (PubChem CID 54100440) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-3-(2,4-difluorophenyl)propanoate.
| Compound Name | methyl (2S)-2-acetamido-3-(2,4-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 54100440 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | methyl (2S)-2-acetamido-3-(2,4-difluorophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(F)cc1F)NC(C)=O |
| InChI | InChI=1S/C12H13F2NO3/c1-7(16)15-11(12(17)18-2)5-8-3-4-9(13)6-10(8)14/h3-4,6,11H,5H2,1-2H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | NADVECNFJILKKC-NSHDSACASA-N |
| XLogP | 1.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |