C17H15F2NO4 — CID 71304179
(2S)-3-(2,4-difluorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 71304179) has the molecular formula C17H15F2NO4 and a molecular weight of 335.31 g/mol. Its IUPAC name is (2S)-3-(2,4-difluorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-(2,4-difluorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 71304179 |
| Molecular Formula | C17H15F2NO4 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (2S)-3-(2,4-difluorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(F)cc1F)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C17H15F2NO4/c18-13-7-6-12(14(19)9-13)8-15(16(21)22)20-17(23)24-10-11-4-2-1-3-5-11/h1-7,9,15H,8,10H2,(H,20,23)(H,21,22)/t15-/m0/s1 |
| InChIKey | LBVDADAIUVLMQO-HNNXBMFYSA-N |
| XLogP | 2.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |