C17H14F3NO4 — CID 66639561
2-(phenylmethoxycarbonylamino)-3-(2,4,5-trifluorophenyl)propanoic acid (PubChem CID 66639561) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is 2-(phenylmethoxycarbonylamino)-3-(2,4,5-trifluorophenyl)propanoic acid.
| Compound Name | 2-(phenylmethoxycarbonylamino)-3-(2,4,5-trifluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 66639561 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-(phenylmethoxycarbonylamino)-3-(2,4,5-trifluorophenyl)propanoic acid |
| SMILES | O=C(NC(Cc1cc(F)c(F)cc1F)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C17H14F3NO4/c18-12-8-14(20)13(19)6-11(12)7-15(16(22)23)21-17(24)25-9-10-4-2-1-3-5-10/h1-6,8,15H,7,9H2,(H,21,24)(H,22,23) |
| InChIKey | CYQKVDZQYUQHJQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|