C19H18F3NO4 — CID 66771528
(2R)-2-methyl-3-(phenylmethoxycarbonylamino)-4-(2,4,5-trifluorophenyl)butanoic acid (PubChem CID 66771528) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is (2R)-2-methyl-3-(phenylmethoxycarbonylamino)-4-(2,4,5-trifluorophenyl)butanoic acid.
| Compound Name | (2R)-2-methyl-3-(phenylmethoxycarbonylamino)-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 66771528 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (2R)-2-methyl-3-(phenylmethoxycarbonylamino)-4-(2,4,5-trifluorophenyl)butanoic acid |
| SMILES | C[C@@H](C(=O)O)C(Cc1cc(F)c(F)cc1F)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18F3NO4/c1-11(18(24)25)17(8-13-7-15(21)16(22)9-14(13)20)23-19(26)27-10-12-5-3-2-4-6-12/h2-7,9,11,17H,8,10H2,1H3,(H,23,26)(H,24,25)/t11-,17?/m1/s1 |
| InChIKey | WSJZXHKKTWAOJV-VCQTYVLVSA-N |
| XLogP | 3.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|