C16H16FNO2 — CID 11346335
benzyl N-[(1R)-1-fluoro-2-phenylethyl]carbamate (PubChem CID 11346335) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is benzyl N-[(1R)-1-fluoro-2-phenylethyl]carbamate.
| Compound Name | benzyl N-[(1R)-1-fluoro-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 11346335 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | benzyl N-[(1R)-1-fluoro-2-phenylethyl]carbamate |
| SMILES | O=C(N[C@H](F)Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C16H16FNO2/c17-15(11-13-7-3-1-4-8-13)18-16(19)20-12-14-9-5-2-6-10-14/h1-10,15H,11-12H2,(H,18,19)/t15-/m0/s1 |
| InChIKey | KOHPTSHLCVGKBK-HNNXBMFYSA-N |
| XLogP | 3.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|