C10H10F3NO3 — CID 825900
benzyl N-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]carbamate (PubChem CID 825900) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is benzyl N-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]carbamate.
| Compound Name | benzyl N-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 825900 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | benzyl N-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]carbamate |
| SMILES | O=C(N[C@@H](O)C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C10H10F3NO3/c11-10(12,13)8(15)14-9(16)17-6-7-4-2-1-3-5-7/h1-5,8,15H,6H2,(H,14,16)/t8-/m0/s1 |
| InChIKey | HXWXCYLZKBKLEX-QMMMGPOBSA-N |
| XLogP | 1.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|