C14H16F3NO4 — CID 162782346
ethyl 4,4,4-trifluoro-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 162782346) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | ethyl 4,4,4-trifluoro-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 162782346 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | ethyl 4,4,4-trifluoro-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CCOC(=O)CC(NC(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO4/c1-2-21-12(19)8-11(14(15,16)17)18-13(20)22-9-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,18,20) |
| InChIKey | BUVYNQDFRGQXFU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |