C16H23NO4 — CID 54226118
ethyl (3S)-4-methyl-3-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 54226118) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is ethyl (3S)-4-methyl-3-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | ethyl (3S)-4-methyl-3-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 54226118 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | ethyl (3S)-4-methyl-3-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C16H23NO4/c1-4-20-15(18)10-14(12(2)3)17-16(19)21-11-13-8-6-5-7-9-13/h5-9,12,14H,4,10-11H2,1-3H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | QFZCDHXLLOXKDG-AWEZNQCLSA-N |
| XLogP | 2.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |