C20H28N2O7 — CID 87252193
ethyl (3R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-3-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 87252193) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is ethyl (3R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-3-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | ethyl (3R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-3-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 87252193 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | ethyl (3R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-3-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCOC(=O)C[C@@H](NC(=O)OCc1ccccc1)C(C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28N2O7/c1-5-27-17(24)11-15(16(12-23)22-19(26)29-20(2,3)4)21-18(25)28-13-14-9-7-6-8-10-14/h6-10,12,15-16H,5,11,13H2,1-4H3,(H,21,25)(H,22,26)/t15-,16?/m1/s1 |
| InChIKey | YUBDFXUJXAYOCK-AAFJCEBUSA-N |
| XLogP | 2.33 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|