C20H27NO6 — CID 141481393
6-O-tert-butyl 1-O-ethyl (E,4S)-4-(phenylmethoxycarbonylamino)hex-2-enedioate (PubChem CID 141481393) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-ethyl (E,4S)-4-(phenylmethoxycarbonylamino)hex-2-enedioate.
| Compound Name | 6-O-tert-butyl 1-O-ethyl (E,4S)-4-(phenylmethoxycarbonylamino)hex-2-enedioate |
|---|---|
| PubChem CID | 141481393 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 6-O-tert-butyl 1-O-ethyl (E,4S)-4-(phenylmethoxycarbonylamino)hex-2-enedioate |
| SMILES | CCOC(=O)/C=C/[C@H](CC(=O)OC(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H27NO6/c1-5-25-17(22)12-11-16(13-18(23)27-20(2,3)4)21-19(24)26-14-15-9-7-6-8-10-15/h6-12,16H,5,13-14H2,1-4H3,(H,21,24)/b12-11+/t16-/m1/s1 |
| InChIKey | CDGXATNWTKKOJZ-LPQFERQCSA-N |
| XLogP | 3.13 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|